C17H16BrNO4 — CID 7834241
[2-(2-bromo-4-methylanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 7834241) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 7834241 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@H](O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C17H16BrNO4/c1-11-7-8-14(13(18)9-11)19-15(20)10-23-17(22)16(21)12-5-3-2-4-6-12/h2-9,16,21H,10H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | QMZZUDMDLLAXKA-MRXNPFEDSA-N |
| XLogP | 2.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |