C16H11Cl3FNO3 — CID 7796348
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(2-fluorophenyl)acetate (PubChem CID 7796348) has the molecular formula C16H11Cl3FNO3 and a molecular weight of 390.63 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(2-fluorophenyl)acetate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7796348 |
| Molecular Formula | C16H11Cl3FNO3 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(2-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1F)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3FNO3/c17-10-6-12(19)14(7-11(10)18)21-15(22)8-24-16(23)5-9-3-1-2-4-13(9)20/h1-4,6-7H,5,8H2,(H,21,22) |
| InChIKey | ALBPHUWIGTVLQJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|