C16H12Cl3NO3 — CID 8633362
[2-(2,3-dichloroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate (PubChem CID 8633362) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8633362 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1Cl)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl3NO3/c17-11-5-2-1-4-10(11)8-15(22)23-9-14(21)20-13-7-3-6-12(18)16(13)19/h1-7H,8-9H2,(H,20,21) |
| InChIKey | KZESKVKKZIAAOS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |