C12H13Cl2NO3 — CID 7782625
[2-(2,3-dichloroanilino)-2-oxoethyl] 2-methylpropanoate (PubChem CID 7782625) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 7782625 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c1-7(2)12(17)18-6-10(16)15-9-5-3-4-8(13)11(9)14/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | HMRJJJDQCWEBTC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |