C16H12BrFN2O4 — CID 7478277
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-fluorobenzoate (PubChem CID 7478277) has the molecular formula C16H12BrFN2O4 and a molecular weight of 395.18 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-fluorobenzoate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 7478277 |
| Molecular Formula | C16H12BrFN2O4 |
| Molecular Weight | 395.18 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H12BrFN2O4/c17-13-4-2-1-3-12(13)15(22)20-19-14(21)9-24-16(23)10-5-7-11(18)8-6-10/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | UJGKDLICZDZXHK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|