C16H11Cl2FN2O4 — CID 7724098
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 7724098) has the molecular formula C16H11Cl2FN2O4 and a molecular weight of 385.18 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7724098 |
| Molecular Formula | C16H11Cl2FN2O4 |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)cc(Cl)c1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C16H11Cl2FN2O4/c17-10-5-9(6-11(18)7-10)16(24)25-8-14(22)20-21-15(23)12-3-1-2-4-13(12)19/h1-7H,8H2,(H,20,22)(H,21,23) |
| InChIKey | FYDZFGZYWYGASE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|