C17H12FN3O4S — CID 4779917
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate (PubChem CID 4779917) has the molecular formula C17H12FN3O4S and a molecular weight of 373.37 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4779917 |
| Molecular Formula | C17H12FN3O4S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ncsc2c1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H12FN3O4S/c18-12-4-2-1-3-11(12)16(23)21-20-15(22)8-25-17(24)10-5-6-13-14(7-10)26-9-19-13/h1-7,9H,8H2,(H,20,22)(H,21,23) |
| InChIKey | SVNOADLFEXPZBV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|