C12H10N2O4S — CID 2561880
(2-acetamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate (PubChem CID 2561880) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2-acetamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate.
| Compound Name | (2-acetamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 2561880 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (2-acetamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate |
| SMILES | CC(=O)NC(=O)COC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H10N2O4S/c1-7(15)14-11(16)5-18-12(17)8-2-3-9-10(4-8)19-6-13-9/h2-4,6H,5H2,1H3,(H,14,15,16) |
| InChIKey | GLMWVABBFHCNNY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |