C14H16N2O4S — CID 8001319
[2-(3-methoxypropylamino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate (PubChem CID 8001319) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 8001319 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
| SMILES | COCCCNC(=O)COC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-19-6-2-5-15-13(17)8-20-14(18)10-3-4-11-12(7-10)21-9-16-11/h3-4,7,9H,2,5-6,8H2,1H3,(H,15,17) |
| InChIKey | QSWPWZRCOXEJEQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|