(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate

C15H10FNO2S — CID 18080757

IUPAC(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate
SMILESO=C(OCc1cccc(F)c1)c1ccc2ncsc2c1
InChIInChI=1S/C15H10FNO2S/c16-12-3-1-2-10(6-12)8-19-15(18)11-4-5-13-14(7-11)20-9-17-13/h1-7,9H,8H2
InChIKeyBJTFOBFAGCQFMN-UHFFFAOYSA-N
MW287.31 g/mol
LogP3.79
Rot. Bonds3

About (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate

(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate (PubChem CID 18080757) has the molecular formula C15H10FNO2S and a molecular weight of 287.31 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate.

Molecular Properties

Compound Name(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate
PubChem CID18080757
Molecular FormulaC15H10FNO2S
Molecular Weight287.31 g/mol
Exact Mass287.04
IUPAC Name(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate
SMILESO=C(OCc1cccc(F)c1)c1ccc2ncsc2c1
InChIInChI=1S/C15H10FNO2S/c16-12-3-1-2-10(6-12)8-19-15(18)11-4-5-13-14(7-11)20-9-17-13/h1-7,9H,8H2
InChIKeyBJTFOBFAGCQFMN-UHFFFAOYSA-N
XLogP3.79
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.31
LogP ≤ 53.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate?
The IUPAC name of (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate (CID 18080757) is (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate.
What is the SMILES notation for (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate?
The canonical SMILES for (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate is O=C(OCc1cccc(F)c1)c1ccc2ncsc2c1.
What is the InChIKey of (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate?
The InChIKey is BJTFOBFAGCQFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNO2S/c16-12-3-1-2-10(6-12)8-19-15(18)11-4-5-13-14(7-11)20-9-17-13/h1-7,9H,8H2.
What are the key properties of (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate?
(3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate has a molecular weight of 287.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl 1,3-benzothiazole-6-carboxylate is sourced from PubChem (CID 18080757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).