C22H15FN2O3 — CID 2304267
(3-fluorophenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate (PubChem CID 2304267) has the molecular formula C22H15FN2O3 and a molecular weight of 374.37 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate.
| Compound Name | (3-fluorophenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 2304267 |
| Molecular Formula | C22H15FN2O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (3-fluorophenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
| SMILES | O=C(OCc1cccc(F)c1)c1cccc(-c2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C22H15FN2O3/c23-19-11-4-6-15(12-19)14-27-22(26)18-10-5-9-17(13-18)21-25-24-20(28-21)16-7-2-1-3-8-16/h1-13H,14H2 |
| InChIKey | OXDUFBHUKXBOQN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |