C29H20N2O4 — CID 2301804
(3-benzoylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate (PubChem CID 2301804) has the molecular formula C29H20N2O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is (3-benzoylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate.
| Compound Name | (3-benzoylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 2301804 |
| Molecular Formula | C29H20N2O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (3-benzoylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
| SMILES | O=C(OCc1cccc(C(=O)c2ccccc2)c1)c1cccc(-c2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C29H20N2O4/c32-26(21-10-3-1-4-11-21)23-14-7-9-20(17-23)19-34-29(33)25-16-8-15-24(18-25)28-31-30-27(35-28)22-12-5-2-6-13-22/h1-18H,19H2 |
| InChIKey | WEIINWYEQOCOFM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |