C20H15N3O3 — CID 47009513
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-pyrrol-1-ylbenzoate (PubChem CID 47009513) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-pyrrol-1-ylbenzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 47009513 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-pyrrol-1-ylbenzoate |
| SMILES | O=C(OCc1nnc(-c2ccccc2)o1)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C20H15N3O3/c24-20(16-9-6-10-17(13-16)23-11-4-5-12-23)25-14-18-21-22-19(26-18)15-7-2-1-3-8-15/h1-13H,14H2 |
| InChIKey | PMQHOCCVTKUTFH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |