C20H15N3O5 — CID 7204486
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204486) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204486 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCc1nnc(-c2ccccc2)o1)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C20H15N3O5/c24-17-9-10-18(25)23(17)15-8-4-7-14(11-15)20(26)27-12-16-21-22-19(28-16)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2 |
| InChIKey | GGWXDESPNHAXRI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|