C19H18N2O3 — CID 7472802
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2,4,6-trimethylbenzoate (PubChem CID 7472802) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2,4,6-trimethylbenzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 7472802 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCc2nnc(-c3ccccc3)o2)c(C)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-12-9-13(2)17(14(3)10-12)19(22)23-11-16-20-21-18(24-16)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3 |
| InChIKey | KJFIKOKUOLXUNJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |