C24H20N2O6S — CID 2640045
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 2640045) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2640045 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccccc2C(=O)OCc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C24H20N2O6S/c1-16-12-13-17(2)21(14-16)33(28,29)32-20-11-7-6-10-19(20)24(27)30-15-22-25-26-23(31-22)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3 |
| InChIKey | PJNCWQMOSZVXAD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|