C21H25NO6S — CID 2535132
[2-(butylamino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 2535132) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2535132 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | CCCCNC(=O)COC(=O)c1ccccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H25NO6S/c1-4-5-12-22-20(23)14-27-21(24)17-8-6-7-9-18(17)28-29(25,26)19-13-15(2)10-11-16(19)3/h6-11,13H,4-5,12,14H2,1-3H3,(H,22,23) |
| InChIKey | RPNKYGWLVOHMAX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|