C25H23NO8S — CID 2535315
methyl 2-[[2-[2-(2,5-dimethylphenyl)sulfonyloxybenzoyl]oxyacetyl]amino]benzoate (PubChem CID 2535315) has the molecular formula C25H23NO8S and a molecular weight of 497.53 g/mol. Its IUPAC name is methyl 2-[[2-[2-(2,5-dimethylphenyl)sulfonyloxybenzoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-(2,5-dimethylphenyl)sulfonyloxybenzoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2535315 |
| Molecular Formula | C25H23NO8S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | methyl 2-[[2-[2-(2,5-dimethylphenyl)sulfonyloxybenzoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1ccccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C25H23NO8S/c1-16-12-13-17(2)22(14-16)35(30,31)34-21-11-7-5-9-19(21)25(29)33-15-23(27)26-20-10-6-4-8-18(20)24(28)32-3/h4-14H,15H2,1-3H3,(H,26,27) |
| InChIKey | LBDIBGBSNLLQKC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|