C24H23NO6S2 — CID 16543615
[2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 16543615) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 16543615 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)c2ccccc2OS(=O)(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H23NO6S2/c1-16-11-12-17(2)22(13-16)33(28,29)31-21-10-5-4-9-20(21)24(27)30-15-23(26)25-18-7-6-8-19(14-18)32-3/h4-14H,15H2,1-3H3,(H,25,26) |
| InChIKey | IXNWVLVCEISKLW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|