C16H15NO4S — CID 2684879
[2-(3-methylsulfanylanilino)-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 2684879) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 2684879 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C16H15NO4S/c1-22-12-6-4-5-11(9-12)17-15(19)10-21-16(20)13-7-2-3-8-14(13)18/h2-9,18H,10H2,1H3,(H,17,19) |
| InChIKey | UORBDYJUHHXZDB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |