About [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate
[2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate (PubChem CID 2684929) has the molecular formula C16H14INO3S
and a molecular weight of 427.26 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate.
Molecular Properties
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate |
| PubChem CID | 2684929 |
| Molecular Formula | C16H14INO3S |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)c2cccc(I)c2)c1 |
| InChI | InChI=1S/C16H14INO3S/c1-22-14-7-3-6-13(9-14)18-15(19)10-21-16(20)11-4-2-5-12(17)8-11/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | OELFSHLUFRZDHZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate?
The IUPAC name of [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate (CID 2684929) is [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate.
What is the SMILES notation for [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate?
The canonical SMILES for [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate is CSc1cccc(NC(=O)COC(=O)c2cccc(I)c2)c1.
What is the InChIKey of [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate?
The InChIKey is OELFSHLUFRZDHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14INO3S/c1-22-14-7-3-6-13(9-14)18-15(19)10-21-16(20)11-4-2-5-12(17)8-11/h2-9H,10H2,1H3,(H,18,19).
What are the key properties of [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate?
[2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate has a molecular weight of 427.26 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methylsulfanylanilino)-2-oxoethyl] 3-iodobenzoate is sourced from PubChem (CID 2684929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).