C18H15NO4S — CID 7284197
[2-(3-methylsulfanylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 7284197) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7284197 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | CSc1cccc(NC(=O)COC(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C18H15NO4S/c1-24-14-7-4-6-13(10-14)19-17(20)11-22-18(21)16-9-12-5-2-3-8-15(12)23-16/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | NPYFWFYXYLSNTF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |