C20H19NO7 — CID 16502963
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-benzofuran-2-carboxylate (PubChem CID 16502963) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16502963 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-benzofuran-2-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc3ccccc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO7/c1-24-15-9-13(10-16(25-2)19(15)26-3)21-18(22)11-27-20(23)17-8-12-6-4-5-7-14(12)28-17/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | HOYDVGNADUQCLZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |