C25H20N2O6 — CID 42978396
[2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 42978396) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 42978396 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)COC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H20N2O6/c1-31-21-9-5-3-7-19(21)27-24(29)16-10-12-18(13-11-16)26-23(28)15-32-25(30)22-14-17-6-2-4-8-20(17)33-22/h2-14H,15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | LNMYQGUICTXMJV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |