C23H18N2O3S2 — CID 16529575
[2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 16529575) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 16529575 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)c2ccccc2Sc2ccccc2C#N)c1 |
| InChI | InChI=1S/C23H18N2O3S2/c1-29-18-9-6-8-17(13-18)25-22(26)15-28-23(27)19-10-3-5-12-21(19)30-20-11-4-2-7-16(20)14-24/h2-13H,15H2,1H3,(H,25,26) |
| InChIKey | ZAZOMLVMPBFKBE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |