C19H16N2O5S — CID 2570918
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 2570918) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 2570918 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccccc1Sc1ccccc1C#N |
| InChI | InChI=1S/C19H16N2O5S/c1-2-25-19(24)21-17(22)12-26-18(23)14-8-4-6-10-16(14)27-15-9-5-3-7-13(15)11-20/h3-10H,2,12H2,1H3,(H,21,22,24) |
| InChIKey | LKCXJJOLBNGRGR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |