C14H17NO5S — CID 8658568
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate (PubChem CID 8658568) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658568 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccccc1SCC |
| InChI | InChI=1S/C14H17NO5S/c1-3-19-14(18)15-12(16)9-20-13(17)10-7-5-6-8-11(10)21-4-2/h5-8H,3-4,9H2,1-2H3,(H,15,16,18) |
| InChIKey | REVQFKLYHXIBNX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |