C13H16N2O7S — CID 7740541
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-(methanesulfonamido)benzoate (PubChem CID 7740541) has the molecular formula C13H16N2O7S and a molecular weight of 344.35 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 7740541 |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(methanesulfonamido)benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C13H16N2O7S/c1-3-21-13(18)14-11(16)8-22-12(17)9-6-4-5-7-10(9)15-23(2,19)20/h4-7,15H,3,8H2,1-2H3,(H,14,16,18) |
| InChIKey | JIFGCAZKRGELOL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |