C18H21NO6S — CID 24530371
2-(4-ethoxyphenoxy)ethyl 2-(methanesulfonamido)benzoate (PubChem CID 24530371) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-(methanesulfonamido)benzoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 24530371 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-(methanesulfonamido)benzoate |
| SMILES | CCOc1ccc(OCCOC(=O)c2ccccc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21NO6S/c1-3-23-14-8-10-15(11-9-14)24-12-13-25-18(20)16-6-4-5-7-17(16)19-26(2,21)22/h4-11,19H,3,12-13H2,1-2H3 |
| InChIKey | PPCPSHPVNJBAHG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|