benzyl 2-(2-cyanophenyl)sulfanylbenzoate

C21H15NO2S — CID 2377363

IUPACbenzyl 2-(2-cyanophenyl)sulfanylbenzoate
SMILESN#Cc1ccccc1Sc1ccccc1C(=O)OCc1ccccc1
InChIInChI=1S/C21H15NO2S/c22-14-17-10-4-6-12-19(17)25-20-13-7-5-11-18(20)21(23)24-15-16-8-2-1-3-9-16/h1-13H,15H2
InChIKeyDIXNJPLJYRTWJK-UHFFFAOYSA-N
MW345.42 g/mol
LogP5.07
Rot. Bonds5

About benzyl 2-(2-cyanophenyl)sulfanylbenzoate

benzyl 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 2377363) has the molecular formula C21H15NO2S and a molecular weight of 345.42 g/mol. Its IUPAC name is benzyl 2-(2-cyanophenyl)sulfanylbenzoate.

Molecular Properties

Compound Namebenzyl 2-(2-cyanophenyl)sulfanylbenzoate
PubChem CID2377363
Molecular FormulaC21H15NO2S
Molecular Weight345.42 g/mol
Exact Mass345.08
IUPAC Namebenzyl 2-(2-cyanophenyl)sulfanylbenzoate
SMILESN#Cc1ccccc1Sc1ccccc1C(=O)OCc1ccccc1
InChIInChI=1S/C21H15NO2S/c22-14-17-10-4-6-12-19(17)25-20-13-7-5-11-18(20)21(23)24-15-16-8-2-1-3-9-16/h1-13H,15H2
InChIKeyDIXNJPLJYRTWJK-UHFFFAOYSA-N
XLogP5.07
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500345.42
LogP ≤ 55.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-(2-cyanophenyl)sulfanylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(2-cyanophenyl)sulfanylbenzoate?
The IUPAC name of benzyl 2-(2-cyanophenyl)sulfanylbenzoate (CID 2377363) is benzyl 2-(2-cyanophenyl)sulfanylbenzoate.
What is the SMILES notation for benzyl 2-(2-cyanophenyl)sulfanylbenzoate?
The canonical SMILES for benzyl 2-(2-cyanophenyl)sulfanylbenzoate is N#Cc1ccccc1Sc1ccccc1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-(2-cyanophenyl)sulfanylbenzoate?
The InChIKey is DIXNJPLJYRTWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO2S/c22-14-17-10-4-6-12-19(17)25-20-13-7-5-11-18(20)21(23)24-15-16-8-2-1-3-9-16/h1-13H,15H2.
What are the key properties of benzyl 2-(2-cyanophenyl)sulfanylbenzoate?
benzyl 2-(2-cyanophenyl)sulfanylbenzoate has a molecular weight of 345.42 g/mol, XLogP of 5.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2-cyanophenyl)sulfanylbenzoate is sourced from PubChem (CID 2377363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).