C22H22N2O3S — CID 7832648
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 7832648) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 7832648 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1ccccc1Sc1ccccc1C#N |
| InChI | InChI=1S/C22H22N2O3S/c1-16-8-6-7-13-24(16)21(25)15-27-22(26)18-10-3-5-12-20(18)28-19-11-4-2-9-17(19)14-23/h2-5,9-12,16H,6-8,13,15H2,1H3/t16-/m1/s1 |
| InChIKey | XFZXPDNCNWMANZ-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |