C19H21NO3 — CID 2558282
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] naphthalene-1-carboxylate (PubChem CID 2558282) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] naphthalene-1-carboxylate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 2558282 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] naphthalene-1-carboxylate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H21NO3/c1-14-7-4-5-12-20(14)18(21)13-23-19(22)17-11-6-9-15-8-2-3-10-16(15)17/h2-3,6,8-11,14H,4-5,7,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | NQLNJZBZYJVURP-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |