C18H25NO6 — CID 16523934
[2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 16523934) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 16523934 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCCCC2C)c(OC)c1OC |
| InChI | InChI=1S/C18H25NO6/c1-12-7-5-6-10-19(12)15(20)11-25-18(21)13-8-9-14(22-2)17(24-4)16(13)23-3/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | SJIFTGFETZZOPC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |