C16H19F2NO4 — CID 55327333
[2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 55327333) has the molecular formula C16H19F2NO4 and a molecular weight of 327.33 g/mol. Its IUPAC name is [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 55327333 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | CC1CCCCN1C(=O)COC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H19F2NO4/c1-11-6-4-5-9-19(11)14(20)10-22-15(21)12-7-2-3-8-13(12)23-16(17)18/h2-3,7-8,11,16H,4-6,9-10H2,1H3 |
| InChIKey | XCAYNSLGSKZPIG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |