C22H23ClN2O4 — CID 8537798
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]benzoate (PubChem CID 8537798) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]benzoate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 8537798 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]benzoate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O4/c1-15-6-4-5-13-25(15)20(26)14-29-22(28)18-7-2-3-8-19(18)24-21(27)16-9-11-17(23)12-10-16/h2-3,7-12,15H,4-6,13-14H2,1H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | RLAUUZWFFLVPPZ-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |