C23H27NO5 — CID 55317036
[2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate (PubChem CID 55317036) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate.
| Compound Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 55317036 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate |
| SMILES | CC1CCCCN1C(=O)COC(=O)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-18-9-7-8-14-24(18)22(25)17-29-23(26)20-12-5-6-13-21(20)28-16-15-27-19-10-3-2-4-11-19/h2-6,10-13,18H,7-9,14-17H2,1H3 |
| InChIKey | NOCDKKJCCKSWEZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|