C21H29NO6 — CID 9197855
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 9197855) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 9197855 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCC[C@H]3CCCC[C@@H]32)c(OC)c1OC |
| InChI | InChI=1S/C21H29NO6/c1-25-17-11-10-15(19(26-2)20(17)27-3)21(24)28-13-18(23)22-12-6-8-14-7-4-5-9-16(14)22/h10-11,14,16H,4-9,12-13H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | CSKARSSBUCYUMW-ZBFHGGJFSA-N |
| XLogP | 3.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |