C22H27N3O4 — CID 8644222
[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 8644222) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 8644222 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCC(=O)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C22H27N3O4/c1-28-19-14-25(17-10-3-2-4-11-17)23-21(19)22(27)29-15-20(26)24-13-7-9-16-8-5-6-12-18(16)24/h2-4,10-11,14,16,18H,5-9,12-13,15H2,1H3/t16-,18+/m0/s1 |
| InChIKey | ZVONGLGZEWXMCL-FUHWJXTLSA-N |
| XLogP | 3.22 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |