C16H18N2O3 — CID 71885554
(2-methylcyclopropyl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 71885554) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2-methylcyclopropyl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | (2-methylcyclopropyl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 71885554 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2-methylcyclopropyl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCC1CC1C |
| InChI | InChI=1S/C16H18N2O3/c1-11-8-12(11)10-21-16(19)15-14(20-2)9-18(17-15)13-6-4-3-5-7-13/h3-7,9,11-12H,8,10H2,1-2H3 |
| InChIKey | GRBHUMAWAYQFFB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |