C16H21NO5 — CID 41105144
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 41105144) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 41105144 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | COc1ccc(O)c(C(=O)OCC(=O)N2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C16H21NO5/c1-11-5-3-4-8-17(11)15(19)10-22-16(20)13-9-12(21-2)6-7-14(13)18/h6-7,9,11,18H,3-5,8,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | HGNLBHWPEAUFPC-LLVKDONJSA-N |
| XLogP | 1.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |