C23H24N2O3S — CID 7414672
[(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 7414672) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 7414672 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CC1CCN(C(=O)[C@H](C)OC(=O)c2ccccc2Sc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C23H24N2O3S/c1-16-11-13-25(14-12-16)22(26)17(2)28-23(27)19-8-4-6-10-21(19)29-20-9-5-3-7-18(20)15-24/h3-10,16-17H,11-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | GMUCXLCIDWCFNH-KRWDZBQOSA-N |
| XLogP | 4.51 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |