C17H23NO5S — CID 18080328
[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate (PubChem CID 18080328) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate.
| Compound Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18080328 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
| SMILES | CC1CCN(C(=O)C(C)OC(=O)c2ccccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H23NO5S/c1-12-8-10-18(11-9-12)16(19)13(2)23-17(20)14-6-4-5-7-15(14)24(3,21)22/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | JAJZWHFEWNPCCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |