C46H36O6S2 — CID 162156911
benzyl 2-[9,10-dioxo-5-(2-phenylmethoxycarbonylphenyl)sulfanylanthracen-1-yl]sulfanylbenzoate;ethene (PubChem CID 162156911) has the molecular formula C46H36O6S2 and a molecular weight of 748.92 g/mol. Its IUPAC name is benzyl 2-[9,10-dioxo-5-(2-phenylmethoxycarbonylphenyl)sulfanylanthracen-1-yl]sulfanylbenzoate;ethene.
| Compound Name | benzyl 2-[9,10-dioxo-5-(2-phenylmethoxycarbonylphenyl)sulfanylanthracen-1-yl]sulfanylbenzoate;ethene |
|---|---|
| PubChem CID | 162156911 |
| Molecular Formula | C46H36O6S2 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.20 |
| IUPAC Name | benzyl 2-[9,10-dioxo-5-(2-phenylmethoxycarbonylphenyl)sulfanylanthracen-1-yl]sulfanylbenzoate;ethene |
| SMILES | C=C.C=C.O=C(OCc1ccccc1)c1ccccc1Sc1cccc2c1C(=O)c1cccc(Sc3ccccc3C(=O)OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C42H28O6S2.2C2H4/c43-39-32-20-12-24-36(50-34-22-10-8-18-30(34)42(46)48-26-28-15-5-2-6-16-28)38(32)40(44)31-19-11-23-35(37(31)39)49-33-21-9-7-17-29(33)41(45)47-25-27-13-3-1-4-14-27;2*1-2/h1-24H,25-26H2;2*1-2H2 |
| InChIKey | ZLYICYRZDMNLML-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|