C23H16O4S — CID 7694423
(4-methylsulfanylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate (PubChem CID 7694423) has the molecular formula C23H16O4S and a molecular weight of 388.44 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | (4-methylsulfanylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 7694423 |
| Molecular Formula | C23H16O4S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CSc1ccc(COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H16O4S/c1-28-15-11-9-14(10-12-15)13-27-23(26)19-8-4-7-18-20(19)22(25)17-6-3-2-5-16(17)21(18)24/h2-12H,13H2,1H3 |
| InChIKey | OSYHHGOPMGYMPU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|