(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate

C22H17NO2S — CID 7522795

IUPAC(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate
SMILESCSc1ccc(COC(=O)c2ccccc2-c2ccccc2C#N)cc1
InChIInChI=1S/C22H17NO2S/c1-26-18-12-10-16(11-13-18)15-25-22(24)21-9-5-4-8-20(21)19-7-3-2-6-17(19)14-23/h2-13H,15H2,1H3
InChIKeyMDTLHGHBCWPGCU-UHFFFAOYSA-N
MW359.45 g/mol
LogP5.30
Rot. Bonds5

About (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate

(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate (PubChem CID 7522795) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate.

Molecular Properties

Compound Name(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate
PubChem CID7522795
Molecular FormulaC22H17NO2S
Molecular Weight359.45 g/mol
Exact Mass359.10
IUPAC Name(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate
SMILESCSc1ccc(COC(=O)c2ccccc2-c2ccccc2C#N)cc1
InChIInChI=1S/C22H17NO2S/c1-26-18-12-10-16(11-13-18)15-25-22(24)21-9-5-4-8-20(21)19-7-3-2-6-17(19)14-23/h2-13H,15H2,1H3
InChIKeyMDTLHGHBCWPGCU-UHFFFAOYSA-N
XLogP5.30
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500359.45
LogP ≤ 55.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate?
The IUPAC name of (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate (CID 7522795) is (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate.
What is the SMILES notation for (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate?
The canonical SMILES for (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate is CSc1ccc(COC(=O)c2ccccc2-c2ccccc2C#N)cc1.
What is the InChIKey of (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate?
The InChIKey is MDTLHGHBCWPGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO2S/c1-26-18-12-10-16(11-13-18)15-25-22(24)21-9-5-4-8-20(21)19-7-3-2-6-17(19)14-23/h2-13H,15H2,1H3.
What are the key properties of (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate?
(4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate has a molecular weight of 359.45 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylsulfanylphenyl)methyl 2-(2-cyanophenyl)benzoate is sourced from PubChem (CID 7522795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).