(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate

C21H13Cl2NO2 — CID 7520296

IUPAC(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate
SMILESN#Cc1ccccc1-c1ccccc1C(=O)OCc1ccc(Cl)cc1Cl
InChIInChI=1S/C21H13Cl2NO2/c22-16-10-9-15(20(23)11-16)13-26-21(25)19-8-4-3-7-18(19)17-6-2-1-5-14(17)12-24/h1-11H,13H2
InChIKeyGDZQUZVNSASLDO-UHFFFAOYSA-N
MW382.25 g/mol
LogP5.89
Rot. Bonds4

About (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate

(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate (PubChem CID 7520296) has the molecular formula C21H13Cl2NO2 and a molecular weight of 382.25 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate.

Molecular Properties

Compound Name(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate
PubChem CID7520296
Molecular FormulaC21H13Cl2NO2
Molecular Weight382.25 g/mol
Exact Mass381.03
IUPAC Name(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate
SMILESN#Cc1ccccc1-c1ccccc1C(=O)OCc1ccc(Cl)cc1Cl
InChIInChI=1S/C21H13Cl2NO2/c22-16-10-9-15(20(23)11-16)13-26-21(25)19-8-4-3-7-18(19)17-6-2-1-5-14(17)12-24/h1-11H,13H2
InChIKeyGDZQUZVNSASLDO-UHFFFAOYSA-N
XLogP5.89
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500382.25
LogP ≤ 55.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate?
The IUPAC name of (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate (CID 7520296) is (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate.
What is the SMILES notation for (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate?
The canonical SMILES for (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate is N#Cc1ccccc1-c1ccccc1C(=O)OCc1ccc(Cl)cc1Cl.
What is the InChIKey of (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate?
The InChIKey is GDZQUZVNSASLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl2NO2/c22-16-10-9-15(20(23)11-16)13-26-21(25)19-8-4-3-7-18(19)17-6-2-1-5-14(17)12-24/h1-11H,13H2.
What are the key properties of (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate?
(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate has a molecular weight of 382.25 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate is sourced from PubChem (CID 7520296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).