C21H13Cl2NO2 — CID 7520296
(2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate (PubChem CID 7520296) has the molecular formula C21H13Cl2NO2 and a molecular weight of 382.25 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 7520296 |
| Molecular Formula | C21H13Cl2NO2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-(2-cyanophenyl)benzoate |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H13Cl2NO2/c22-16-10-9-15(20(23)11-16)13-26-21(25)19-8-4-3-7-18(19)17-6-2-1-5-14(17)12-24/h1-11H,13H2 |
| InChIKey | GDZQUZVNSASLDO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |