C24H28Cl2O4 — CID 91720374
2-O-[(2,4-dichlorophenyl)methyl] 1-O-nonyl benzene-1,2-dicarboxylate (PubChem CID 91720374) has the molecular formula C24H28Cl2O4 and a molecular weight of 451.39 g/mol. Its IUPAC name is 2-O-[(2,4-dichlorophenyl)methyl] 1-O-nonyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(2,4-dichlorophenyl)methyl] 1-O-nonyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720374 |
| Molecular Formula | C24H28Cl2O4 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-O-[(2,4-dichlorophenyl)methyl] 1-O-nonyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccccc1C(=O)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H28Cl2O4/c1-2-3-4-5-6-7-10-15-29-23(27)20-11-8-9-12-21(20)24(28)30-17-18-13-14-19(25)16-22(18)26/h8-9,11-14,16H,2-7,10,15,17H2,1H3 |
| InChIKey | CXEDXLICTVHBCL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|