C21H22Cl2O4 — CID 91719711
2-O-(2,5-dichlorophenyl) 1-O-heptyl benzene-1,2-dicarboxylate (PubChem CID 91719711) has the molecular formula C21H22Cl2O4 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-O-(2,5-dichlorophenyl) 1-O-heptyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(2,5-dichlorophenyl) 1-O-heptyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719711 |
| Molecular Formula | C21H22Cl2O4 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-O-(2,5-dichlorophenyl) 1-O-heptyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H22Cl2O4/c1-2-3-4-5-8-13-26-20(24)16-9-6-7-10-17(16)21(25)27-19-14-15(22)11-12-18(19)23/h6-7,9-12,14H,2-5,8,13H2,1H3 |
| InChIKey | BHDGHAKSHHNOGZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|