C20H19F3O4 — CID 91719143
1-O-pentyl 2-O-[(2,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91719143) has the molecular formula C20H19F3O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-O-pentyl 2-O-[(2,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-pentyl 2-O-[(2,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719143 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-O-pentyl 2-O-[(2,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)OCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H19F3O4/c1-2-3-6-9-26-19(24)14-7-4-5-8-15(14)20(25)27-12-13-10-17(22)18(23)11-16(13)21/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3 |
| InChIKey | UEFHFVYGPCHOSJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|