C21H21F3O4 — CID 91720130
1-O-hexyl 2-O-[(3,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91720130) has the molecular formula C21H21F3O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-O-hexyl 2-O-[(3,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-hexyl 2-O-[(3,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720130 |
| Molecular Formula | C21H21F3O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-O-hexyl 2-O-[(3,4,5-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccccc1C(=O)OCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H21F3O4/c1-2-3-4-7-10-27-20(25)15-8-5-6-9-16(15)21(26)28-13-14-11-17(22)19(24)18(23)12-14/h5-6,8-9,11-12H,2-4,7,10,13H2,1H3 |
| InChIKey | ULBJFEIEWGNKLU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|